vicparks50 vicparks50

02-12-2019
Physics

contestada

When the volleyball rises in the air, what does the force of gravity cause the volleyball to do

Respuesta :

DaMooseman DaMooseman

02-12-2019

The force of gravity causes it to fall to the ground

Answer Link

Otras preguntas

Does the sentence state a fact or an opinion? The number of students who say that they spend over three hours a night on homework is unacceptable.

How did the actions of kink George 3rd and his parliament cause the American revolution?

each to keep it is able to carry for tropical birds at once during one show nine zookeeper presented Birds how many birds were shown all together

123 An expression representing the area of a square is 4n". For what value(s) of n is the expression 4n reasonable? Choose the correct answer below. OA. The val

What would be the coordinate points for these? (I need 3 x and y) will give brainliest!!

what is the answer to this equation? 2x +3=9

Which stable molecule would probably not exist? A. CH3OH B. VH2O C. CH3O D. C2H2 E. C3H4

cosec(6b+pi/8)=sec(2b-pi/8)

Cuanto es diez más diez

Which situation shows a constant rate of change? A. The number of points scored during a volleyball game and the time played, in minutes. B. The height of an