EmandijaAdeezy EmandijaAdeezy

01-08-2016
Biology

contestada

____are two or more types of tissue that work together to perform a specific function.

Respuesta :

Аноним Аноним

01-08-2016

A structure composed of two or more tissues that work together to perform a particular function is called an organ.so it is an orga

Answer Link

Otras preguntas

please help me with this question

What was the outcome of the Proclamation of 1763

DUE TUESDAY WILL MARK BRAINLIEST ANSWER-assuming there is enough light and water for photosynthesis to occur, explain why a temperature between 0°c and 35°c is

what does "to run" in Spanish mean

cosec(6b+pi/8)=sec(2b-pi/8)

Can someone help me answer this question? “Describe the ways in which earths “spheres” overlap each other”

Find how much was investedat each rate if $20,000 more was invested at 7%than at 5%what would be its equation

Identify the vertex, the axis of symmetry, the maximum or minimum value, and the domain and range of the function. f(x)= -(x - 9)2 - 20 Identify the vertex. The

a sentence for the word imbecile

There is a line that includes the point (1,10) and has a slope of 2. What is its equation in slope-intercept form?