jarmijo1875 jarmijo1875

02-09-2020
Mathematics

contestada

Which number completes the series: 1, 3, 6, 10, 15, ???

Respuesta :

Tootie1993 Tootie1993

02-09-2020

Answer:

21

best of luck!

Answer Link

flikitrix flikitrix

02-09-2020

Answer:

21

Step-by-step explanation:

1 + 2 = 3

3 + 3 = 6

6 + 4 = 10

10 + 5 = 15

15 + 6 = 21

Hope it helps

Mark it as Brainliest!

Answer Link

Otras preguntas

Which of the following would you use to view organelles? hand lens compound light microscope electron microscope basic light microscope

Which equation is represented by the table? x y (x, y) 0 –1 (0, –1) 1 4 (1, 4) 2 9 (2, 9) A. y = 3x + 3 B. y = 5x – 1 C. y = –3x + 3 D. y = 3x – 4

What happens when a proton is brought near another proton?

A juggler has a bag containing three yellow balls, six green balls, three blue balls, and one red ball, all the same size. The juggler pulls a ball from the bag

cos(x/3)cos(x/3)=1/2(1+cos(2x/3))

How are oceans and rivers barriers to human trade, movement, and migration? Check all that apply. A. They are a natural boundary. B. They divide landmass

How do I do this number 24

what steps would you take to compare 2 kilograms and 3200 grams

Which salt has a pH < 7? KBr HCOOK CaSO4 NH4NO3

Which of the following statements is an observation? A. Drivers like getting to places quickly because it gives them a sense of control. B. When motorists enjoy